C27H33N7O5S — CID 177056513
3-[2-[[1-[4-[[2-[[4-(dimethylamino)phenyl]diazenyl]-1,3-benzothiazol-6-yl]oxy]butyl]triazol-4-yl]methoxy]ethoxy]propanoic acid (PubChem CID 177056513) has the molecular formula C27H33N7O5S and a molecular weight of 567.67 g/mol. Its IUPAC name is 3-[2-[[1-[4-[[2-[[4-(dimethylamino)phenyl]diazenyl]-1,3-benzothiazol-6-yl]oxy]butyl]triazol-4-yl]methoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[[1-[4-[[2-[[4-(dimethylamino)phenyl]diazenyl]-1,3-benzothiazol-6-yl]oxy]butyl]triazol-4-yl]methoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 177056513 |
| Molecular Formula | C27H33N7O5S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 3-[2-[[1-[4-[[2-[[4-(dimethylamino)phenyl]diazenyl]-1,3-benzothiazol-6-yl]oxy]butyl]triazol-4-yl]methoxy]ethoxy]propanoic acid |
| SMILES | CN(C)c1ccc(/N=N/c2nc3ccc(OCCCCn4cc(COCCOCCC(=O)O)nn4)cc3s2)cc1 |
| InChI | InChI=1S/C27H33N7O5S/c1-33(2)22-7-5-20(6-8-22)29-31-27-28-24-10-9-23(17-25(24)40-27)39-13-4-3-12-34-18-21(30-32-34)19-38-16-15-37-14-11-26(35)36/h5-10,17-18H,3-4,11-16,19H2,1-2H3,(H,35,36)/b31-29+ |
| InChIKey | WBHPQWSAMFUAMV-OWWNRXNESA-N |
| XLogP | 5.24 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|