C33H63N — CID 177061061
4,5-dipropyloctane;propane;4-(2,4,6-trimethylhept-5-en-2-yl)aniline (PubChem CID 177061061) has the molecular formula C33H63N and a molecular weight of 473.87 g/mol. Its IUPAC name is 4,5-dipropyloctane;propane;4-(2,4,6-trimethylhept-5-en-2-yl)aniline.
| Compound Name | 4,5-dipropyloctane;propane;4-(2,4,6-trimethylhept-5-en-2-yl)aniline |
|---|---|
| PubChem CID | 177061061 |
| Molecular Formula | C33H63N |
| Molecular Weight | 473.87 g/mol |
| Exact Mass | 473.50 |
| IUPAC Name | 4,5-dipropyloctane;propane;4-(2,4,6-trimethylhept-5-en-2-yl)aniline |
| SMILES | CC(C)=CC(C)CC(C)(C)c1ccc(N)cc1.CCC.CCCC(CCC)C(CCC)CCC |
| InChI | InChI=1S/C16H25N.C14H30.C3H8/c1-12(2)10-13(3)11-16(4,5)14-6-8-15(17)9-7-14;1-5-9-13(10-6-2)14(11-7-3)12-8-4;1-3-2/h6-10,13H,11,17H2,1-5H3;13-14H,5-12H2,1-4H3;3H2,1-2H3 |
| InChIKey | RNJDADTVLPCDGI-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.87 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|