C25H36O2 — CID 143292660
4-[7-(4-hydroxyphenyl)-2,4,7,8-tetramethylnonan-2-yl]phenol (PubChem CID 143292660) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is 4-[7-(4-hydroxyphenyl)-2,4,7,8-tetramethylnonan-2-yl]phenol.
| Compound Name | 4-[7-(4-hydroxyphenyl)-2,4,7,8-tetramethylnonan-2-yl]phenol |
|---|---|
| PubChem CID | 143292660 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 4-[7-(4-hydroxyphenyl)-2,4,7,8-tetramethylnonan-2-yl]phenol |
| SMILES | CC(CCC(C)(c1ccc(O)cc1)C(C)C)CC(C)(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H36O2/c1-18(2)25(6,21-9-13-23(27)14-10-21)16-15-19(3)17-24(4,5)20-7-11-22(26)12-8-20/h7-14,18-19,26-27H,15-17H2,1-6H3 |
| InChIKey | CHEBFBQDYJVVGI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |