C8H9NO2 — CID 177065357
7-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one (PubChem CID 177065357) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 7-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one.
| Compound Name | 7-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 177065357 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 7-methyl-5,6-dihydro-3H-1,3-benzoxazol-2-one |
| SMILES | CC1=c2oc(=O)[nH]c2=CCC1 |
| InChI | InChI=1S/C8H9NO2/c1-5-3-2-4-6-7(5)11-8(10)9-6/h4H,2-3H2,1H3,(H,9,10) |
| InChIKey | DLYMFNBPIDQWCF-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |