C7H7NO2 — CID 69153790
5,6-dihydro-3H-1,3-benzoxazol-2-one (PubChem CID 69153790) has the molecular formula C7H7NO2 and a molecular weight of 137.14 g/mol. Its IUPAC name is 5,6-dihydro-3H-1,3-benzoxazol-2-one.
| Compound Name | 5,6-dihydro-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 69153790 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | 5,6-dihydro-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2c(o1)=CCCC=2 |
| InChI | InChI=1S/C7H7NO2/c9-7-8-5-3-1-2-4-6(5)10-7/h3-4H,1-2H2,(H,8,9) |
| InChIKey | YTSFKQYWJBQGMM-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |