C3H2ClNO3 — CID 69333997
4-chloro-5-hydroxy-3H-1,3-oxazol-2-one (PubChem CID 69333997) has the molecular formula C3H2ClNO3 and a molecular weight of 135.51 g/mol. Its IUPAC name is 4-chloro-5-hydroxy-3H-1,3-oxazol-2-one.
| Compound Name | 4-chloro-5-hydroxy-3H-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 69333997 |
| Molecular Formula | C3H2ClNO3 |
| Molecular Weight | 135.51 g/mol |
| Exact Mass | 134.97 |
| IUPAC Name | 4-chloro-5-hydroxy-3H-1,3-oxazol-2-one |
| SMILES | O=c1[nH]c(Cl)c(O)o1 |
| InChI | InChI=1S/C3H2ClNO3/c4-1-2(6)8-3(7)5-1/h6H,(H,5,7) |
| InChIKey | IDPHDIXBCMAHPR-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.51 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |