C74H63N3 — CID 177067030
3-[[11,11-bis(4-tert-butylphenyl)benzo[b]fluoren-2-yl]-[9-(4-tert-butylphenyl)-9-phenylfluoren-2-yl]amino]-5-isocyanobenzonitrile (PubChem CID 177067030) has the molecular formula C74H63N3 and a molecular weight of 994.34 g/mol. Its IUPAC name is 3-[[11,11-bis(4-tert-butylphenyl)benzo[b]fluoren-2-yl]-[9-(4-tert-butylphenyl)-9-phenylfluoren-2-yl]amino]-5-isocyanobenzonitrile.
| Compound Name | 3-[[11,11-bis(4-tert-butylphenyl)benzo[b]fluoren-2-yl]-[9-(4-tert-butylphenyl)-9-phenylfluoren-2-yl]amino]-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 177067030 |
| Molecular Formula | C74H63N3 |
| Molecular Weight | 994.34 g/mol |
| Exact Mass | 993.50 |
| IUPAC Name | 3-[[11,11-bis(4-tert-butylphenyl)benzo[b]fluoren-2-yl]-[9-(4-tert-butylphenyl)-9-phenylfluoren-2-yl]amino]-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1cc(C#N)cc(N(c2ccc3c(c2)C(c2ccccc2)(c2ccc(C(C)(C)C)cc2)c2ccccc2-3)c2ccc3c(c2)C(c2ccc(C(C)(C)C)cc2)(c2ccc(C(C)(C)C)cc2)c2cc4ccccc4cc2-3)c1 |
| InChI | InChI=1S/C74H63N3/c1-70(2,3)51-24-30-55(31-25-51)73(54-20-12-11-13-21-54)66-23-17-16-22-62(66)63-38-36-59(45-68(63)73)77(61-41-48(47-75)40-58(44-61)76-10)60-37-39-64-65-42-49-18-14-15-19-50(49)43-67(65)74(69(64)46-60,56-32-26-52(27-33-56)71(4,5)6)57-34-28-53(29-35-57)72(7,8)9/h11-46H,1-9H3 |
| InChIKey | YBJJTNHECYRPRH-UHFFFAOYSA-N |
| XLogP | 19.35 |
| TPSA | 31.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.34 |
| LogP ≤ 5 | 19.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|