C29H45N9O8S — CID 177078031
2-amino-N-[6-[2-(2-aminoethoxy)ethoxy]hexyl-[[2-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]sulfamoyl]-3-phenylpropanamide (PubChem CID 177078031) has the molecular formula C29H45N9O8S and a molecular weight of 679.80 g/mol. Its IUPAC name is 2-amino-N-[6-[2-(2-aminoethoxy)ethoxy]hexyl-[[2-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]sulfamoyl]-3-phenylpropanamide.
| Compound Name | 2-amino-N-[6-[2-(2-aminoethoxy)ethoxy]hexyl-[[2-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]sulfamoyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 177078031 |
| Molecular Formula | C29H45N9O8S |
| Molecular Weight | 679.80 g/mol |
| Exact Mass | 679.31 |
| IUPAC Name | 2-amino-N-[6-[2-(2-aminoethoxy)ethoxy]hexyl-[[2-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]sulfamoyl]-3-phenylpropanamide |
| SMILES | NCCOCCOCCCCCCN(CC1(n2cnc3c(N)ncnc32)OCC(O)C1O)S(=O)(=O)NC(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C29H45N9O8S/c30-10-13-45-15-14-44-12-7-2-1-6-11-37(47(42,43)36-28(41)22(31)16-21-8-4-3-5-9-21)18-29(25(40)23(39)17-46-29)38-20-35-24-26(32)33-19-34-27(24)38/h3-5,8-9,19-20,22-23,25,39-40H,1-2,6-7,10-18,30-31H2,(H,36,41)(H2,32,33,34) |
| InChIKey | SSXCHCIWTSUVCT-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 256.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.80 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|