C11H15N5O3 — CID 91509236
(2S,3S,4S)-2-(aminomethyl)-2-(6-methylpurin-9-yl)oxolane-3,4-diol (PubChem CID 91509236) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is (2S,3S,4S)-2-(aminomethyl)-2-(6-methylpurin-9-yl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4S)-2-(aminomethyl)-2-(6-methylpurin-9-yl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 91509236 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (2S,3S,4S)-2-(aminomethyl)-2-(6-methylpurin-9-yl)oxolane-3,4-diol |
| SMILES | Cc1ncnc2c1ncn2[C@@]1(CN)OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15N5O3/c1-6-8-10(14-4-13-6)16(5-15-8)11(3-12)9(18)7(17)2-19-11/h4-5,7,9,17-18H,2-3,12H2,1H3/t7-,9-,11-/m0/s1 |
| InChIKey | NMSKYLMJMCQWDQ-ARENWVFISA-N |
| XLogP | -1.50 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |