C14H16N2O3 — CID 177083501
[(2R,3S,4S)-4-hydroxy-2-[(4-isocyanophenyl)methyl]pyrrolidin-3-yl] acetate (PubChem CID 177083501) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is [(2R,3S,4S)-4-hydroxy-2-[(4-isocyanophenyl)methyl]pyrrolidin-3-yl] acetate.
| Compound Name | [(2R,3S,4S)-4-hydroxy-2-[(4-isocyanophenyl)methyl]pyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 177083501 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | [(2R,3S,4S)-4-hydroxy-2-[(4-isocyanophenyl)methyl]pyrrolidin-3-yl] acetate |
| SMILES | [C-]#[N+]c1ccc(C[C@H]2NC[C@H](O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C14H16N2O3/c1-9(17)19-14-12(16-8-13(14)18)7-10-3-5-11(15-2)6-4-10/h3-6,12-14,16,18H,7-8H2,1H3/t12-,13+,14+/m1/s1 |
| InChIKey | RVXIPXRXVDPXNJ-RDBSUJKOSA-N |
| XLogP | 1.04 |
| TPSA | 62.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|