C14H16O2S2Sn — CID 177085574
S-[acetylsulfanyl-di(cyclopenta-2,4-dien-1-yl)stannyl] ethanethioate (PubChem CID 177085574) has the molecular formula C14H16O2S2Sn and a molecular weight of 399.13 g/mol. Its IUPAC name is S-[acetylsulfanyl-di(cyclopenta-2,4-dien-1-yl)stannyl] ethanethioate.
| Compound Name | S-[acetylsulfanyl-di(cyclopenta-2,4-dien-1-yl)stannyl] ethanethioate |
|---|---|
| PubChem CID | 177085574 |
| Molecular Formula | C14H16O2S2Sn |
| Molecular Weight | 399.13 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | S-[acetylsulfanyl-di(cyclopenta-2,4-dien-1-yl)stannyl] ethanethioate |
| SMILES | CC(=O)S[Sn](SC(C)=O)(C1C=CC=C1)C1C=CC=C1 |
| InChI | InChI=1S/2C5H5.2C2H4OS.Sn/c2*1-2-4-5-3-1;2*1-2(3)4;/h2*1-5H;2*1H3,(H,3,4);/q;;;;+2/p-2 |
| InChIKey | WZHLNIYNLBISRP-UHFFFAOYSA-L |
| XLogP | 3.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.13 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|