C34H53N5O6S2 — CID 177099457
3-N-[3-[(4-formylbenzoyl)amino]propyl]-1,5-dimethyl-5-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-ylheptane-1,3,5-tricarboxamide (PubChem CID 177099457) has the molecular formula C34H53N5O6S2 and a molecular weight of 691.96 g/mol. Its IUPAC name is 3-N-[3-[(4-formylbenzoyl)amino]propyl]-1,5-dimethyl-5-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-ylheptane-1,3,5-tricarboxamide.
| Compound Name | 3-N-[3-[(4-formylbenzoyl)amino]propyl]-1,5-dimethyl-5-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-ylheptane-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 177099457 |
| Molecular Formula | C34H53N5O6S2 |
| Molecular Weight | 691.96 g/mol |
| Exact Mass | 691.34 |
| IUPAC Name | 3-N-[3-[(4-formylbenzoyl)amino]propyl]-1,5-dimethyl-5-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-ylheptane-1,3,5-tricarboxamide |
| SMILES | C=C(C)C(=O)NCCSSCCNC(=O)C(C)(CC)CC(CC(C)C(=O)NC(C)C)C(=O)NCCCNC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C34H53N5O6S2/c1-8-34(7,33(45)38-17-19-47-46-18-16-37-29(41)23(2)3)21-28(20-25(6)30(42)39-24(4)5)32(44)36-15-9-14-35-31(43)27-12-10-26(22-40)11-13-27/h10-13,22,24-25,28H,2,8-9,14-21H2,1,3-7H3,(H,35,43)(H,36,44)(H,37,41)(H,38,45)(H,39,42) |
| InChIKey | IECAMAUXEXALFQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 162.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.96 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|