C36H67N5O5S3 — CID 174360808
1,3,3,4,6,6,7-heptamethyl-7-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-yl-4-N-[3-(3-sulfanylpropanoylamino)propyl]nonane-1,4,7-tricarboxamide (PubChem CID 174360808) has the molecular formula C36H67N5O5S3 and a molecular weight of 746.16 g/mol. Its IUPAC name is 1,3,3,4,6,6,7-heptamethyl-7-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-yl-4-N-[3-(3-sulfanylpropanoylamino)propyl]nonane-1,4,7-tricarboxamide.
| Compound Name | 1,3,3,4,6,6,7-heptamethyl-7-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-yl-4-N-[3-(3-sulfanylpropanoylamino)propyl]nonane-1,4,7-tricarboxamide |
|---|---|
| PubChem CID | 174360808 |
| Molecular Formula | C36H67N5O5S3 |
| Molecular Weight | 746.16 g/mol |
| Exact Mass | 745.43 |
| IUPAC Name | 1,3,3,4,6,6,7-heptamethyl-7-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-yl-4-N-[3-(3-sulfanylpropanoylamino)propyl]nonane-1,4,7-tricarboxamide |
| SMILES | C=C(C)C(=O)NCCSSCCNC(=O)C(C)(CC)C(C)(C)CC(C)(C(=O)NCCCNC(=O)CCS)C(C)(C)CC(C)C(=O)NC(C)C |
| InChI | InChI=1S/C36H67N5O5S3/c1-13-35(11,31(45)40-19-22-49-48-21-18-38-29(43)25(2)3)34(9,10)24-36(12,32(46)39-17-14-16-37-28(42)15-20-47)33(7,8)23-27(6)30(44)41-26(4)5/h26-27,47H,2,13-24H2,1,3-12H3,(H,37,42)(H,38,43)(H,39,46)(H,40,45)(H,41,44) |
| InChIKey | JZOTXXCYSZAFCV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.16 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|