C22H42N4O9 — CID 123746252
2-ethyl-2,4-dimethyl-N-[3-[[2-[(E)-[(2R,3R,4S)-2,3,4,5,5-pentahydroxypentylidene]amino]oxyacetyl]amino]propyl]-N'-propan-2-ylpentanediamide (PubChem CID 123746252) has the molecular formula C22H42N4O9 and a molecular weight of 506.60 g/mol. Its IUPAC name is 2-ethyl-2,4-dimethyl-N-[3-[[2-[(E)-[(2R,3R,4S)-2,3,4,5,5-pentahydroxypentylidene]amino]oxyacetyl]amino]propyl]-N'-propan-2-ylpentanediamide.
| Compound Name | 2-ethyl-2,4-dimethyl-N-[3-[[2-[(E)-[(2R,3R,4S)-2,3,4,5,5-pentahydroxypentylidene]amino]oxyacetyl]amino]propyl]-N'-propan-2-ylpentanediamide |
|---|---|
| PubChem CID | 123746252 |
| Molecular Formula | C22H42N4O9 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | 2-ethyl-2,4-dimethyl-N-[3-[[2-[(E)-[(2R,3R,4S)-2,3,4,5,5-pentahydroxypentylidene]amino]oxyacetyl]amino]propyl]-N'-propan-2-ylpentanediamide |
| SMILES | CCC(C)(CC(C)C(=O)NC(C)C)C(=O)NCCCNC(=O)CO/N=C/[C@@H](O)[C@@H](O)[C@H](O)C(O)O |
| InChI | InChI=1S/C22H42N4O9/c1-6-22(5,10-14(4)19(31)26-13(2)3)21(34)24-9-7-8-23-16(28)12-35-25-11-15(27)17(29)18(30)20(32)33/h11,13-15,17-18,20,27,29-30,32-33H,6-10,12H2,1-5H3,(H,23,28)(H,24,34)(H,26,31)/b25-11+/t14?,15-,17-,18+,22?/m1/s1 |
| InChIKey | XVUWYHYXVFVYIZ-NMKJDGDGSA-N |
| XLogP | -2.03 |
| TPSA | 210.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|