C30H51N5O5S2 — CID 177099452
3-N-[4-(ethynylamino)-4-oxobutyl]-1,3,5-trimethyl-5-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-ylheptane-1,3,5-tricarboxamide (PubChem CID 177099452) has the molecular formula C30H51N5O5S2 and a molecular weight of 625.90 g/mol. Its IUPAC name is 3-N-[4-(ethynylamino)-4-oxobutyl]-1,3,5-trimethyl-5-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-ylheptane-1,3,5-tricarboxamide.
| Compound Name | 3-N-[4-(ethynylamino)-4-oxobutyl]-1,3,5-trimethyl-5-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-ylheptane-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 177099452 |
| Molecular Formula | C30H51N5O5S2 |
| Molecular Weight | 625.90 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | 3-N-[4-(ethynylamino)-4-oxobutyl]-1,3,5-trimethyl-5-N-[2-[2-(2-methylprop-2-enoylamino)ethyldisulfanyl]ethyl]-1-N-propan-2-ylheptane-1,3,5-tricarboxamide |
| SMILES | C#CNC(=O)CCCNC(=O)C(C)(CC(C)C(=O)NC(C)C)CC(C)(CC)C(=O)NCCSSCCNC(=O)C(=C)C |
| InChI | InChI=1S/C30H51N5O5S2/c1-10-29(8,27(39)34-16-18-42-41-17-15-32-25(37)21(3)4)20-30(9,19-23(7)26(38)35-22(5)6)28(40)33-14-12-13-24(36)31-11-2/h2,22-23H,3,10,12-20H2,1,4-9H3,(H,31,36)(H,32,37)(H,33,40)(H,34,39)(H,35,38) |
| InChIKey | XBXBTSBDRVILIT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|