C32H42N4O3 — CID 135170426
N-[3-[[3-formyl-10-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]anthracen-9-yl]methylamino]propyl]-2,2-dimethylpropanamide (PubChem CID 135170426) has the molecular formula C32H42N4O3 and a molecular weight of 530.71 g/mol. Its IUPAC name is N-[3-[[3-formyl-10-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]anthracen-9-yl]methylamino]propyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[[3-formyl-10-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]anthracen-9-yl]methylamino]propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 135170426 |
| Molecular Formula | C32H42N4O3 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | N-[3-[[3-formyl-10-[[3-(2-methylprop-2-enoylamino)propylamino]methyl]anthracen-9-yl]methylamino]propyl]-2,2-dimethylpropanamide |
| SMILES | C=C(C)C(=O)NCCCNCc1c2ccccc2c(CNCCCNC(=O)C(C)(C)C)c2ccc(C=O)cc12 |
| InChI | InChI=1S/C32H42N4O3/c1-22(2)30(38)35-16-8-14-34-20-29-25-11-7-6-10-24(25)28(26-13-12-23(21-37)18-27(26)29)19-33-15-9-17-36-31(39)32(3,4)5/h6-7,10-13,18,21,33-34H,1,8-9,14-17,19-20H2,2-5H3,(H,35,38)(H,36,39) |
| InChIKey | HDDNWPJLQZFLBE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|