C37H27N5O2Pt-2 — CID 177109482
CID 177109482 (PubChem CID 177109482) has the molecular formula C37H27N5O2Pt-2 and a molecular weight of 768.73 g/mol.
| Compound Name | CID 177109482 |
|---|---|
| PubChem CID | 177109482 |
| Molecular Formula | C37H27N5O2Pt-2 |
| Molecular Weight | 768.73 g/mol |
| Exact Mass | 768.18 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-c5coc6n[n+](-c7ccccc7)[c-]n56)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C37H27N5O2.Pt/c1-37(2,3)26-18-19-38-35(21-26)42-32-15-8-7-14-30(32)31-17-16-29(22-33(31)42)44-28-13-9-10-25(20-28)34-23-43-36-39-41(24-40(34)36)27-11-5-4-6-12-27;/h4-19,21,23H,1-3H3;/q-2; |
| InChIKey | CNHGOOOGGJDGEF-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 61.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.73 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|