C38H30N6OPt-2 — CID 177109489
CID 177109489 (PubChem CID 177109489) has the molecular formula C38H30N6OPt-2 and a molecular weight of 781.78 g/mol.
| Compound Name | CID 177109489 |
|---|---|
| PubChem CID | 177109489 |
| Molecular Formula | C38H30N6OPt-2 |
| Molecular Weight | 781.78 g/mol |
| Exact Mass | 781.21 |
| IUPAC Name | — |
| SMILES | C[n+]1[c-]n2c(-c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(C(C)(C)C)ccn4)ccc3)cn(-c3ccccc3)c2n1.[Pt] |
| InChI | InChI=1S/C38H30N6O.Pt/c1-38(2,3)27-19-20-39-36(22-27)44-33-16-9-8-15-31(33)32-18-17-30(23-34(32)44)45-29-14-10-11-26(21-29)35-24-42(28-12-6-5-7-13-28)37-40-41(4)25-43(35)37;/h5-20,22,24H,1-4H3;/q-2; |
| InChIKey | ZTPGIOULUFYOQA-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 53.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.78 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|