C34H30N3OPt- — CID 177110679
4-tert-butyl-2-[1-methyl-4-[3-[6-(trideuteriomethyl)quinolin-8-yl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum (PubChem CID 177110679) has the molecular formula C34H30N3OPt- and a molecular weight of 694.73 g/mol. Its IUPAC name is 4-tert-butyl-2-[1-methyl-4-[3-[6-(trideuteriomethyl)quinolin-8-yl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum.
| Compound Name | 4-tert-butyl-2-[1-methyl-4-[3-[6-(trideuteriomethyl)quinolin-8-yl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 177110679 |
| Molecular Formula | C34H30N3OPt- |
| Molecular Weight | 694.73 g/mol |
| Exact Mass | 694.22 |
| IUPAC Name | 4-tert-butyl-2-[1-methyl-4-[3-[6-(trideuteriomethyl)quinolin-8-yl]benzene-2-id-1-yl]benzimidazol-2-yl]phenol;platinum |
| SMILES | [2H]C([2H])([2H])c1cc(-c2[c-]c(-c3cccc4c3nc(-c3cc(C(C)(C)C)ccc3O)n4C)ccc2)c2ncccc2c1.[Pt] |
| InChI | InChI=1S/C34H30N3O.Pt/c1-21-17-24-11-8-16-35-31(24)27(18-21)23-10-6-9-22(19-23)26-12-7-13-29-32(26)36-33(37(29)5)28-20-25(34(2,3)4)14-15-30(28)38;/h6-18,20,38H,1-5H3;/q-1;/i1D3; |
| InChIKey | RWAJMJOWERCLSO-NIIDSAIPSA-N |
| XLogP | 8.23 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.73 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|