C37H47N5O3 — CID 177118119
3-(8,13-diethyl-3,7,12,17,20-pentamethyl-22,23-dihydroporphyrin-2-yl)-N-[2-(2-hydroxyethoxy)ethyl]-N-methylpropanamide (PubChem CID 177118119) has the molecular formula C37H47N5O3 and a molecular weight of 609.82 g/mol. Its IUPAC name is 3-(8,13-diethyl-3,7,12,17,20-pentamethyl-22,23-dihydroporphyrin-2-yl)-N-[2-(2-hydroxyethoxy)ethyl]-N-methylpropanamide.
| Compound Name | 3-(8,13-diethyl-3,7,12,17,20-pentamethyl-22,23-dihydroporphyrin-2-yl)-N-[2-(2-hydroxyethoxy)ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 177118119 |
| Molecular Formula | C37H47N5O3 |
| Molecular Weight | 609.82 g/mol |
| Exact Mass | 609.37 |
| IUPAC Name | 3-(8,13-diethyl-3,7,12,17,20-pentamethyl-22,23-dihydroporphyrin-2-yl)-N-[2-(2-hydroxyethoxy)ethyl]-N-methylpropanamide |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(C)c5nc(cc1[nH]2)C(C)=C5)C(CCC(=O)N(C)CCOCCO)=C4C)c(C)c3CC |
| InChI | InChI=1S/C37H47N5O3/c1-9-26-23(5)32-20-35-27(10-2)22(4)31(39-35)19-33-24(6)28(11-12-36(44)42(8)13-15-45-16-14-43)37(41-33)25(7)30-17-21(3)29(38-30)18-34(26)40-32/h17-20,39-40,43H,9-16H2,1-8H3/b29-18-,30-25-,31-19-,32-20-,33-19-,34-18-,35-20-,37-25- |
| InChIKey | QSMRVCKNWBJWTM-JQKIIHRTSA-N |
| XLogP | 7.10 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.82 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|