C32H49N3O3Si4 — CID 177125291
1,3-bis[[[4-[dimethyl(prop-1-en-2-yl)silyl]phenyl]-dimethylsilyl]methyl]-5-methyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 177125291) has the molecular formula C32H49N3O3Si4 and a molecular weight of 636.11 g/mol. Its IUPAC name is 1,3-bis[[[4-[dimethyl(prop-1-en-2-yl)silyl]phenyl]-dimethylsilyl]methyl]-5-methyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis[[[4-[dimethyl(prop-1-en-2-yl)silyl]phenyl]-dimethylsilyl]methyl]-5-methyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 177125291 |
| Molecular Formula | C32H49N3O3Si4 |
| Molecular Weight | 636.11 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | 1,3-bis[[[4-[dimethyl(prop-1-en-2-yl)silyl]phenyl]-dimethylsilyl]methyl]-5-methyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=C(C)[Si](C)(C)c1ccc([Si](C)(C)Cn2c(=O)n(C)c(=O)n(C[Si](C)(C)c3ccc([Si](C)(C)C(=C)C)cc3)c2=O)cc1 |
| InChI | InChI=1S/C32H49N3O3Si4/c1-24(2)41(10,11)28-18-14-26(15-19-28)39(6,7)22-34-30(36)33(5)31(37)35(32(34)38)23-40(8,9)27-16-20-29(21-17-27)42(12,13)25(3)4/h14-21H,1,3,22-23H2,2,4-13H3 |
| InChIKey | FBETXJZLNCIDFD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.11 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|