C12H21ClO — CID 177129232
2,3-ditert-butyl-5-chloro-2,3-dihydrofuran (PubChem CID 177129232) has the molecular formula C12H21ClO and a molecular weight of 216.75 g/mol. Its IUPAC name is 2,3-ditert-butyl-5-chloro-2,3-dihydrofuran.
| Compound Name | 2,3-ditert-butyl-5-chloro-2,3-dihydrofuran |
|---|---|
| PubChem CID | 177129232 |
| Molecular Formula | C12H21ClO |
| Molecular Weight | 216.75 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2,3-ditert-butyl-5-chloro-2,3-dihydrofuran |
| SMILES | CC(C)(C)C1C=C(Cl)OC1C(C)(C)C |
| InChI | InChI=1S/C12H21ClO/c1-11(2,3)8-7-9(13)14-10(8)12(4,5)6/h7-8,10H,1-6H3 |
| InChIKey | YJXFQSACQYQKBB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.75 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |