C21H28B3FN6 — CID 177156669
CID 177156669 (PubChem CID 177156669) has the molecular formula C21H28B3FN6 and a molecular weight of 415.93 g/mol.
| Compound Name | CID 177156669 |
|---|---|
| PubChem CID | 177156669 |
| Molecular Formula | C21H28B3FN6 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | — |
| SMILES | CC.CCCF.[B]C([B])([B])Cc1nc(N)nn2ccc(-c3ccc(/N=N/C)c(C)c3)c12 |
| InChI | InChI=1S/C16H15B3N6.C3H7F.C2H6/c1-9-7-10(3-4-12(9)23-21-2)11-5-6-25-14(11)13(8-16(17,18)19)22-15(20)24-25;1-2-3-4;1-2/h3-7H,8H2,1-2H3,(H2,20,24);2-3H2,1H3;1-2H3/b23-21+;; |
| InChIKey | WFCHZOCGUDWLED-GUSGXMBRSA-N |
| XLogP | 4.51 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|