C26H35N6OP — CID 177174852
5-[2-[3-[[2-amino-5-[(Z)-3-methylimino-1-phosphanylprop-1-en-2-yl]-3-pyridinyl]amino]propylamino]ethyl]-1-methylpyridin-2-one;benzene (PubChem CID 177174852) has the molecular formula C26H35N6OP and a molecular weight of 478.58 g/mol. Its IUPAC name is 5-[2-[3-[[2-amino-5-[(Z)-3-methylimino-1-phosphanylprop-1-en-2-yl]-3-pyridinyl]amino]propylamino]ethyl]-1-methylpyridin-2-one;benzene.
| Compound Name | 5-[2-[3-[[2-amino-5-[(Z)-3-methylimino-1-phosphanylprop-1-en-2-yl]-3-pyridinyl]amino]propylamino]ethyl]-1-methylpyridin-2-one;benzene |
|---|---|
| PubChem CID | 177174852 |
| Molecular Formula | C26H35N6OP |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 5-[2-[3-[[2-amino-5-[(Z)-3-methylimino-1-phosphanylprop-1-en-2-yl]-3-pyridinyl]amino]propylamino]ethyl]-1-methylpyridin-2-one;benzene |
| SMILES | C/N=C/C(=C\P)c1cnc(N)c(NCCCNCCc2ccc(=O)n(C)c2)c1.c1ccccc1 |
| InChI | InChI=1S/C20H29N6OP.C6H6/c1-22-11-17(14-28)16-10-18(20(21)25-12-16)24-8-3-7-23-9-6-15-4-5-19(27)26(2)13-15;1-2-4-6-5-3-1/h4-5,10-14,23-24H,3,6-9,28H2,1-2H3,(H2,21,25);1-6H/b17-14+,22-11+; |
| InChIKey | ALYNOTHMMDZYSA-ARNOJOCZSA-N |
| XLogP | 3.60 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|