C15H5F6NO3S — CID 177182328
3-[3-(difluoromethoxy)-2,4,5-trifluorophenyl]-6-fluorothieno[3,2-b]pyridine-2-carboxylic acid (PubChem CID 177182328) has the molecular formula C15H5F6NO3S and a molecular weight of 393.26 g/mol. Its IUPAC name is 3-[3-(difluoromethoxy)-2,4,5-trifluorophenyl]-6-fluorothieno[3,2-b]pyridine-2-carboxylic acid.
| Compound Name | 3-[3-(difluoromethoxy)-2,4,5-trifluorophenyl]-6-fluorothieno[3,2-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 177182328 |
| Molecular Formula | C15H5F6NO3S |
| Molecular Weight | 393.26 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 3-[3-(difluoromethoxy)-2,4,5-trifluorophenyl]-6-fluorothieno[3,2-b]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1sc2cc(F)cnc2c1-c1cc(F)c(F)c(OC(F)F)c1F |
| InChI | InChI=1S/C15H5F6NO3S/c16-4-1-7-11(22-3-4)8(13(26-7)14(23)24)5-2-6(17)10(19)12(9(5)18)25-15(20)21/h1-3,15H,(H,23,24) |
| InChIKey | YWYPKHXWYBOTMH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.26 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|