C16H7F4NO3S — CID 163367114
3-acetyl-6-fluoro-7-(2,3,5-trifluorophenyl)thieno[3,2-b]pyridine-2-carboxylic acid (PubChem CID 163367114) has the molecular formula C16H7F4NO3S and a molecular weight of 369.30 g/mol. Its IUPAC name is 3-acetyl-6-fluoro-7-(2,3,5-trifluorophenyl)thieno[3,2-b]pyridine-2-carboxylic acid.
| Compound Name | 3-acetyl-6-fluoro-7-(2,3,5-trifluorophenyl)thieno[3,2-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 163367114 |
| Molecular Formula | C16H7F4NO3S |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 3-acetyl-6-fluoro-7-(2,3,5-trifluorophenyl)thieno[3,2-b]pyridine-2-carboxylic acid |
| SMILES | CC(=O)c1c(C(=O)O)sc2c(-c3cc(F)cc(F)c3F)c(F)cnc12 |
| InChI | InChI=1S/C16H7F4NO3S/c1-5(22)10-13-14(25-15(10)16(23)24)11(9(19)4-21-13)7-2-6(17)3-8(18)12(7)20/h2-4H,1H3,(H,23,24) |
| InChIKey | DCIIHFVONFWMQW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|