C20H13F4NO3 — CID 167506437
7-fluoro-4-(3-hydroxycyclobutyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylic acid (PubChem CID 167506437) has the molecular formula C20H13F4NO3 and a molecular weight of 391.32 g/mol. Its IUPAC name is 7-fluoro-4-(3-hydroxycyclobutyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylic acid.
| Compound Name | 7-fluoro-4-(3-hydroxycyclobutyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 167506437 |
| Molecular Formula | C20H13F4NO3 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 7-fluoro-4-(3-hydroxycyclobutyl)-8-(2,3,5-trifluorophenyl)quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cnc2c(-c3cc(F)cc(F)c3F)c(F)ccc2c1C1CC(O)C1 |
| InChI | InChI=1S/C20H13F4NO3/c21-9-5-12(18(24)15(23)6-9)17-14(22)2-1-11-16(8-3-10(26)4-8)13(20(27)28)7-25-19(11)17/h1-2,5-8,10,26H,3-4H2,(H,27,28) |
| InChIKey | QCUMAABTWZJCML-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|