C16H9F4NO2S — CID 177182334
3-(3-ethyl-2,4,5-trifluorophenyl)-6-fluorothieno[3,2-b]pyridine-2-carboxylic acid (PubChem CID 177182334) has the molecular formula C16H9F4NO2S and a molecular weight of 355.31 g/mol. Its IUPAC name is 3-(3-ethyl-2,4,5-trifluorophenyl)-6-fluorothieno[3,2-b]pyridine-2-carboxylic acid.
| Compound Name | 3-(3-ethyl-2,4,5-trifluorophenyl)-6-fluorothieno[3,2-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 177182334 |
| Molecular Formula | C16H9F4NO2S |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 3-(3-ethyl-2,4,5-trifluorophenyl)-6-fluorothieno[3,2-b]pyridine-2-carboxylic acid |
| SMILES | CCc1c(F)c(F)cc(-c2c(C(=O)O)sc3cc(F)cnc23)c1F |
| InChI | InChI=1S/C16H9F4NO2S/c1-2-7-12(19)8(4-9(18)13(7)20)11-14-10(3-6(17)5-21-14)24-15(11)16(22)23/h3-5H,2H2,1H3,(H,22,23) |
| InChIKey | AUHKRXRACJDZIH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|