About 5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine
5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine (PubChem CID 177183357) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is 5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine.
Analyze 5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine?
The IUPAC name of 5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine (CID 177183357) is 5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine.
What is the SMILES notation for 5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine?
The canonical SMILES for 5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine is C=CC1=C(SC)CCN=C1CC.
What is the InChIKey of 5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine?
The InChIKey is LYGSUQVVCCSTAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NS/c1-4-8-9(5-2)11-7-6-10(8)12-3/h4H,1,5-7H2,2-3H3.
What are the key properties of 5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine?
5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine has a molecular weight of 181.30 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-6-ethyl-4-methylsulfanyl-2,3-dihydropyridine is sourced from PubChem (CID 177183357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).