C57H111N3O6 — CID 177188906
[8-[2-[3-(dimethylamino)propyl-(ethylcarbamoyl)amino]-2-oxoethyl]-15-(2-hexyldecanoyloxy)pentadecyl] 2-hexyldecanoate (PubChem CID 177188906) has the molecular formula C57H111N3O6 and a molecular weight of 934.53 g/mol. Its IUPAC name is [8-[2-[3-(dimethylamino)propyl-(ethylcarbamoyl)amino]-2-oxoethyl]-15-(2-hexyldecanoyloxy)pentadecyl] 2-hexyldecanoate.
| Compound Name | [8-[2-[3-(dimethylamino)propyl-(ethylcarbamoyl)amino]-2-oxoethyl]-15-(2-hexyldecanoyloxy)pentadecyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 177188906 |
| Molecular Formula | C57H111N3O6 |
| Molecular Weight | 934.53 g/mol |
| Exact Mass | 933.85 |
| IUPAC Name | [8-[2-[3-(dimethylamino)propyl-(ethylcarbamoyl)amino]-2-oxoethyl]-15-(2-hexyldecanoyloxy)pentadecyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCCC(CCCCCCCOC(=O)C(CCCCCC)CCCCCCCC)CC(=O)N(CCCN(C)C)C(=O)NCC |
| InChI | InChI=1S/C57H111N3O6/c1-8-13-17-21-27-35-44-52(42-33-19-15-10-3)55(62)65-48-37-29-23-25-31-40-51(50-54(61)60(57(64)58-12-5)47-39-46-59(6)7)41-32-26-24-30-38-49-66-56(63)53(43-34-20-16-11-4)45-36-28-22-18-14-9-2/h51-53H,8-50H2,1-7H3,(H,58,64) |
| InChIKey | YFJGMCZMUFMTLA-UHFFFAOYSA-N |
| XLogP | 15.94 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.53 |
| LogP ≤ 5 | 15.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|