C32H31BClF5N4O — CID 177201014
CID 177201014 (PubChem CID 177201014) has the molecular formula C32H31BClF5N4O and a molecular weight of 628.88 g/mol.
| Compound Name | CID 177201014 |
|---|---|
| PubChem CID | 177201014 |
| Molecular Formula | C32H31BClF5N4O |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | — |
| SMILES | C=Cc1cc(F)cc(C(F)(F)F)c1.[B]C(O)(CCC)N1C(=C)N(C)c2c1cc(NC)c1c2C(=C)NC1c1cc(F)ccc1Cl |
| InChI | InChI=1S/C23H25BClFN4O.C9H6F4/c1-6-9-23(24,31)30-13(3)29(5)22-18(30)11-17(27-4)20-19(22)12(2)28-21(20)15-10-14(26)7-8-16(15)25;1-2-6-3-7(9(11,12)13)5-8(10)4-6/h7-8,10-11,21,27-28,31H,2-3,6,9H2,1,4-5H3;2-5H,1H2 |
| InChIKey | WKOGOJRZWDXUPA-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 50.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|