C28H16B5ClF4N6 — CID 177201208
CID 177201208 (PubChem CID 177201208) has the molecular formula C28H16B5ClF4N6 and a molecular weight of 601.98 g/mol.
| Compound Name | CID 177201208 |
|---|---|
| PubChem CID | 177201208 |
| Molecular Formula | C28H16B5ClF4N6 |
| Molecular Weight | 601.98 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])C([B])([B])N1C(=C)N(C(F)F)c2c1cc(Nc1ncnc3ccc(F)cc13)c1c2C(=C)NC1c1cc(F)ccc1Cl |
| InChI | InChI=1S/C28H16B5ClF4N6/c1-11-21-22(23(41-11)15-7-13(35)3-5-17(15)34)19(42-25-16-8-14(36)4-6-18(16)39-10-40-25)9-20-24(21)43(26(37)38)12(2)44(20)28(32,33)27(29,30)31/h3-10,23,26,41H,1-2H2,(H,39,40,42) |
| InChIKey | PSEAEFHXFSBWRU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.98 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|