C30H24BClF5N7O2 — CID 177201836
CID 177201836 (PubChem CID 177201836) has the molecular formula C30H24BClF5N7O2 and a molecular weight of 655.82 g/mol.
| Compound Name | CID 177201836 |
|---|---|
| PubChem CID | 177201836 |
| Molecular Formula | C30H24BClF5N7O2 |
| Molecular Weight | 655.82 g/mol |
| Exact Mass | 655.17 |
| IUPAC Name | — |
| SMILES | [H]/N=c1\n(C)c2c3c(c(Nc4cnnc5c(C(F)(F)F)cc(F)cc45)cc2n1C([B])(O)C(C)(C)O)C(c1cc(F)ccc1Cl)NC3=C |
| InChI | InChI=1S/C30H24BClF5N7O2/c1-12-22-23(25(40-12)15-7-13(33)5-6-18(15)32)19(10-21-26(22)43(4)27(38)44(21)30(31,46)28(2,3)45)41-20-11-39-42-24-16(20)8-14(34)9-17(24)29(35,36)37/h5-11,25,38,40,45-46H,1H2,2-4H3,(H,41,42)/b38-27+ |
| InChIKey | DKJWSDOXDXLJSV-ACPRRRJJSA-N |
| XLogP | 5.30 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.82 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|