C26H24F3N3O8S — CID 177204764
benzyl N-[(3S,4R)-3-hydroxy-7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]-N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]carbamate (PubChem CID 177204764) has the molecular formula C26H24F3N3O8S and a molecular weight of 595.55 g/mol. Its IUPAC name is benzyl N-[(3S,4R)-3-hydroxy-7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]-N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]carbamate.
| Compound Name | benzyl N-[(3S,4R)-3-hydroxy-7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]-N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 177204764 |
| Molecular Formula | C26H24F3N3O8S |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | benzyl N-[(3S,4R)-3-hydroxy-7-(trifluoromethyl)-3,4-dihydro-2H-chromen-4-yl]-N-[2-[(2-nitrophenyl)sulfonylamino]ethyl]carbamate |
| SMILES | O=C(OCc1ccccc1)N(CCNS(=O)(=O)c1ccccc1[N+](=O)[O-])[C@@H]1c2ccc(C(F)(F)F)cc2OC[C@H]1O |
| InChI | InChI=1S/C26H24F3N3O8S/c27-26(28,29)18-10-11-19-22(14-18)39-16-21(33)24(19)31(25(34)40-15-17-6-2-1-3-7-17)13-12-30-41(37,38)23-9-5-4-8-20(23)32(35)36/h1-11,14,21,24,30,33H,12-13,15-16H2/t21-,24-/m1/s1 |
| InChIKey | BNJXJDCUTJERKH-ZJSXRUAMSA-N |
| XLogP | 4.03 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|