C19H17F3N2O8S — CID 139604867
2-[[1-[[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]methyl]-3,4-dihydro-1H-isochromen-6-yl]oxy]acetic acid (PubChem CID 139604867) has the molecular formula C19H17F3N2O8S and a molecular weight of 490.41 g/mol. Its IUPAC name is 2-[[1-[[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]methyl]-3,4-dihydro-1H-isochromen-6-yl]oxy]acetic acid.
| Compound Name | 2-[[1-[[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]methyl]-3,4-dihydro-1H-isochromen-6-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 139604867 |
| Molecular Formula | C19H17F3N2O8S |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | 2-[[1-[[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]methyl]-3,4-dihydro-1H-isochromen-6-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1ccc2c(c1)CCOC2CNS(=O)(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17F3N2O8S/c20-19(21,22)12-1-4-17(15(8-12)24(27)28)33(29,30)23-9-16-14-3-2-13(32-10-18(25)26)7-11(14)5-6-31-16/h1-4,7-8,16,23H,5-6,9-10H2,(H,25,26) |
| InChIKey | RAGRCRWLWXHLOK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 145.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|