C17H22F2N2O4S — CID 177207258
tert-butyl (1S,9R,12R)-5-(difluoromethoxy)-12-methyl-8-oxa-11-thia-6,14-diazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-triene-14-carboxylate (PubChem CID 177207258) has the molecular formula C17H22F2N2O4S and a molecular weight of 388.44 g/mol. Its IUPAC name is tert-butyl (1S,9R,12R)-5-(difluoromethoxy)-12-methyl-8-oxa-11-thia-6,14-diazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-triene-14-carboxylate.
| Compound Name | tert-butyl (1S,9R,12R)-5-(difluoromethoxy)-12-methyl-8-oxa-11-thia-6,14-diazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-triene-14-carboxylate |
|---|---|
| PubChem CID | 177207258 |
| Molecular Formula | C17H22F2N2O4S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | tert-butyl (1S,9R,12R)-5-(difluoromethoxy)-12-methyl-8-oxa-11-thia-6,14-diazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5-triene-14-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)[C@H]2c3ccc(OC(F)F)nc3O[C@H]2CS1 |
| InChI | InChI=1S/C17H22F2N2O4S/c1-9-7-21(16(22)25-17(2,3)4)13-10-5-6-12(24-15(18)19)20-14(10)23-11(13)8-26-9/h5-6,9,11,13,15H,7-8H2,1-4H3/t9-,11+,13+/m1/s1 |
| InChIKey | NAWVDBNHGGMRIZ-CDMKHQONSA-N |
| XLogP | 3.86 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |