methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate

C11H12FNO4 — CID 177218586

IUPACmethyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate
SMILESCOC(=O)c1c(F)cc(CO)cc1NC(C)=O
InChIInChI=1S/C11H12FNO4/c1-6(15)13-9-4-7(5-14)3-8(12)10(9)11(16)17-2/h3-4,14H,5H2,1-2H3,(H,13,15)
InChIKeyRIYBGIMHVSIAIF-UHFFFAOYSA-N
MW241.22 g/mol
LogP1.06
Rot. Bonds3

About methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate

methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate (PubChem CID 177218586) has the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. Its IUPAC name is methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate.

Molecular Properties

Compound Namemethyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate
PubChem CID177218586
Molecular FormulaC11H12FNO4
Molecular Weight241.22 g/mol
Exact Mass241.08
IUPAC Namemethyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate
SMILESCOC(=O)c1c(F)cc(CO)cc1NC(C)=O
InChIInChI=1S/C11H12FNO4/c1-6(15)13-9-4-7(5-14)3-8(12)10(9)11(16)17-2/h3-4,14H,5H2,1-2H3,(H,13,15)
InChIKeyRIYBGIMHVSIAIF-UHFFFAOYSA-N
XLogP1.06
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.22
LogP ≤ 51.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate?
The IUPAC name of methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate (CID 177218586) is methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate.
What is the SMILES notation for methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate?
The canonical SMILES for methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate is COC(=O)c1c(F)cc(CO)cc1NC(C)=O.
What is the InChIKey of methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate?
The InChIKey is RIYBGIMHVSIAIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO4/c1-6(15)13-9-4-7(5-14)3-8(12)10(9)11(16)17-2/h3-4,14H,5H2,1-2H3,(H,13,15).
What are the key properties of methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate?
methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate has a molecular weight of 241.22 g/mol, XLogP of 1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-6-fluoro-4-(hydroxymethyl)benzoate is sourced from PubChem (CID 177218586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).