C10H11F3N2OS — CID 177219466
S-(4,4,4-trifluoro-3-pyrazin-2-ylbutyl) ethanethioate (PubChem CID 177219466) has the molecular formula C10H11F3N2OS and a molecular weight of 264.27 g/mol. Its IUPAC name is S-(4,4,4-trifluoro-3-pyrazin-2-ylbutyl) ethanethioate.
| Compound Name | S-(4,4,4-trifluoro-3-pyrazin-2-ylbutyl) ethanethioate |
|---|---|
| PubChem CID | 177219466 |
| Molecular Formula | C10H11F3N2OS |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | S-(4,4,4-trifluoro-3-pyrazin-2-ylbutyl) ethanethioate |
| SMILES | CC(=O)SCCC(c1cnccn1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2OS/c1-7(16)17-5-2-8(10(11,12)13)9-6-14-3-4-15-9/h3-4,6,8H,2,5H2,1H3 |
| InChIKey | FSAVVYDRJCCOFQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|