C17H30O2 — CID 177221715
methyl (1R,4Z)-3-butyl-4-pentylidenecyclohexane-1-carboxylate (PubChem CID 177221715) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is methyl (1R,4Z)-3-butyl-4-pentylidenecyclohexane-1-carboxylate.
| Compound Name | methyl (1R,4Z)-3-butyl-4-pentylidenecyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 177221715 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | methyl (1R,4Z)-3-butyl-4-pentylidenecyclohexane-1-carboxylate |
| SMILES | CCCC/C=C1/CC[C@@H](C(=O)OC)CC1CCCC |
| InChI | InChI=1S/C17H30O2/c1-4-6-8-10-14-11-12-16(17(18)19-3)13-15(14)9-7-5-2/h10,15-16H,4-9,11-13H2,1-3H3/b14-10-/t15?,16-/m1/s1 |
| InChIKey | ZVEHFGBKOFPVFU-DNTJLBHNSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|