C15H26N2 — CID 177223308
(2E,4Z,6Z)-N-methyl-6-piperidin-1-ylnona-2,4,6-trien-3-amine (PubChem CID 177223308) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (2E,4Z,6Z)-N-methyl-6-piperidin-1-ylnona-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z,6Z)-N-methyl-6-piperidin-1-ylnona-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 177223308 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (2E,4Z,6Z)-N-methyl-6-piperidin-1-ylnona-2,4,6-trien-3-amine |
| SMILES | C/C=C(\C=C/C(=C/CC)N1CCCCC1)NC |
| InChI | InChI=1S/C15H26N2/c1-4-9-15(11-10-14(5-2)16-3)17-12-7-6-8-13-17/h5,9-11,16H,4,6-8,12-13H2,1-3H3/b11-10-,14-5+,15-9- |
| InChIKey | BVVXEAKMHSWIQR-UXDLSDRHSA-N |
| XLogP | 3.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|