About (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol
(2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol (PubChem CID 143340474) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol.
Molecular Properties
| Compound Name | (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol |
| PubChem CID | 143340474 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol |
| SMILES | C#C/C=C(\C=C/CO)N1CCC1 |
| InChI | InChI=1S/C10H13NO/c1-2-5-10(6-3-9-12)11-7-4-8-11/h1,3,5-6,12H,4,7-9H2/b6-3-,10-5+ |
| InChIKey | BICHQNWYJOQUQU-VMDKLMDRSA-N |
| XLogP | 0.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol?
The IUPAC name of (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol (CID 143340474) is (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol.
What is the SMILES notation for (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol?
The canonical SMILES for (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol is C#C/C=C(\C=C/CO)N1CCC1.
What is the InChIKey of (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol?
The InChIKey is BICHQNWYJOQUQU-VMDKLMDRSA-N. The full InChI is InChI=1S/C10H13NO/c1-2-5-10(6-3-9-12)11-7-4-8-11/h1,3,5-6,12H,4,7-9H2/b6-3-,10-5+.
What are the key properties of (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol?
(2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol has a molecular weight of 163.22 g/mol, XLogP of 0.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol is sourced from PubChem (CID 143340474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).