C10H13NO — CID 143340474
(2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol (PubChem CID 143340474) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol.
| Compound Name | (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol |
|---|---|
| PubChem CID | 143340474 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (2Z,4E)-4-(azetidin-1-yl)hepta-2,4-dien-6-yn-1-ol |
| SMILES | C#C/C=C(\C=C/CO)N1CCC1 |
| InChI | InChI=1S/C10H13NO/c1-2-5-10(6-3-9-12)11-7-4-8-11/h1,3,5-6,12H,4,7-9H2/b6-3-,10-5+ |
| InChIKey | BICHQNWYJOQUQU-VMDKLMDRSA-N |
| XLogP | 0.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|