About ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile
ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile (PubChem CID 177223536) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile.
Analyze ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile (CID 177223536) is ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile is CC.N#CC1=C(O)C=CCC1.
What is the InChIKey of ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is MTBXHFXYFWARJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C2H6/c8-5-6-3-1-2-4-7(6)9;1-2/h2,4,9H,1,3H2;1-2H3.
What are the key properties of ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile?
ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 151.21 g/mol, XLogP of 2.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-hydroxycyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 177223536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).