C24H32N4O6 — CID 177233769
6-[[(Z)-but-2-enoyl]-formylamino]-N-[2-oxo-2-[[2-oxo-2-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]hexanamide (PubChem CID 177233769) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is 6-[[(Z)-but-2-enoyl]-formylamino]-N-[2-oxo-2-[[2-oxo-2-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]hexanamide.
| Compound Name | 6-[[(Z)-but-2-enoyl]-formylamino]-N-[2-oxo-2-[[2-oxo-2-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]hexanamide |
|---|---|
| PubChem CID | 177233769 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 6-[[(Z)-but-2-enoyl]-formylamino]-N-[2-oxo-2-[[2-oxo-2-[[(2S)-1-oxo-3-phenylpropan-2-yl]amino]ethyl]amino]ethyl]hexanamide |
| SMILES | C/C=C\C(=O)N(C=O)CCCCCC(=O)NCC(=O)NCC(=O)N[C@H](C=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H32N4O6/c1-2-9-24(34)28(18-30)13-8-4-7-12-21(31)25-15-22(32)26-16-23(33)27-20(17-29)14-19-10-5-3-6-11-19/h2-3,5-6,9-11,17-18,20H,4,7-8,12-16H2,1H3,(H,25,31)(H,26,32)(H,27,33)/b9-2-/t20-/m0/s1 |
| InChIKey | ATJXAIYRVRUPSJ-WINJOEAFSA-N |
| XLogP | 0.27 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|