C14H20NY- — CID 177235431
N,N-dimethyl-3-(4-methylbenzene-5-id-1-yl)prop-2-yn-1-amine;ethane;yttrium (PubChem CID 177235431) has the molecular formula C14H20NY- and a molecular weight of 291.23 g/mol. Its IUPAC name is N,N-dimethyl-3-(4-methylbenzene-5-id-1-yl)prop-2-yn-1-amine;ethane;yttrium.
| Compound Name | N,N-dimethyl-3-(4-methylbenzene-5-id-1-yl)prop-2-yn-1-amine;ethane;yttrium |
|---|---|
| PubChem CID | 177235431 |
| Molecular Formula | C14H20NY- |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N,N-dimethyl-3-(4-methylbenzene-5-id-1-yl)prop-2-yn-1-amine;ethane;yttrium |
| SMILES | CC.Cc1[c-]cc(C#CCN(C)C)cc1.[Y] |
| InChI | InChI=1S/C12H14N.C2H6.Y/c1-11-6-8-12(9-7-11)5-4-10-13(2)3;1-2;/h6,8-9H,10H2,1-3H3;1-2H3;/q-1;; |
| InChIKey | WFRJVIVPWLBPAZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|