C13H24O6 — CID 177248438
7-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-3-one (PubChem CID 177248438) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is 7-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-3-one.
| Compound Name | 7-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-3-one |
|---|---|
| PubChem CID | 177248438 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 7-[3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-3-one |
| SMILES | CCC(=O)CCCCOC1OC(CO)CC(O)C1O |
| InChI | InChI=1S/C13H24O6/c1-2-9(15)5-3-4-6-18-13-12(17)11(16)7-10(8-14)19-13/h10-14,16-17H,2-8H2,1H3 |
| InChIKey | MLBKKROAKRDPCP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|