C18H11F4NO4S — CID 177250854
[(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate (PubChem CID 177250854) has the molecular formula C18H11F4NO4S and a molecular weight of 413.35 g/mol. Its IUPAC name is [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate.
| Compound Name | [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 177250854 |
| Molecular Formula | C18H11F4NO4S |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate |
| SMILES | C/C(=N\OC(=O)c1cc(F)cc(C(F)(F)F)c1)C1=CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H11F4NO4S/c1-10(15-9-28(25,26)16-5-3-2-4-14(15)16)23-27-17(24)11-6-12(18(20,21)22)8-13(19)7-11/h2-9H,1H3/b23-10+ |
| InChIKey | APGQQULKGAITMV-AUEPDCJTSA-N |
| XLogP | 4.21 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|