About [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate
[(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate (PubChem CID 177250854) has the molecular formula C18H11F4NO4S
and a molecular weight of 413.35 g/mol. Its IUPAC name is [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate |
| PubChem CID | 177250854 |
| Molecular Formula | C18H11F4NO4S |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate |
| SMILES | C/C(=N\OC(=O)c1cc(F)cc(C(F)(F)F)c1)C1=CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H11F4NO4S/c1-10(15-9-28(25,26)16-5-3-2-4-14(15)16)23-27-17(24)11-6-12(18(20,21)22)8-13(19)7-11/h2-9H,1H3/b23-10+ |
| InChIKey | APGQQULKGAITMV-AUEPDCJTSA-N |
| XLogP | 4.21 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate?
The IUPAC name of [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate (CID 177250854) is [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate.
What is the SMILES notation for [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate?
The canonical SMILES for [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate is C/C(=N\OC(=O)c1cc(F)cc(C(F)(F)F)c1)C1=CS(=O)(=O)c2ccccc21.
What is the InChIKey of [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate?
The InChIKey is APGQQULKGAITMV-AUEPDCJTSA-N. The full InChI is InChI=1S/C18H11F4NO4S/c1-10(15-9-28(25,26)16-5-3-2-4-14(15)16)23-27-17(24)11-6-12(18(20,21)22)8-13(19)7-11/h2-9H,1H3/b23-10+.
What are the key properties of [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate?
[(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate has a molecular weight of 413.35 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(1,1-dioxo-1-benzothiophen-3-yl)ethylideneamino] 3-fluoro-5-(trifluoromethyl)benzoate is sourced from PubChem (CID 177250854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).