C27H15N3O12 — CID 177256099
5-[4,6-bis(3,5-dicarboxyphenyl)triazin-5-yl]benzene-1,3-dicarboxylic acid (PubChem CID 177256099) has the molecular formula C27H15N3O12 and a molecular weight of 573.43 g/mol. Its IUPAC name is 5-[4,6-bis(3,5-dicarboxyphenyl)triazin-5-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[4,6-bis(3,5-dicarboxyphenyl)triazin-5-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 177256099 |
| Molecular Formula | C27H15N3O12 |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 573.07 |
| IUPAC Name | 5-[4,6-bis(3,5-dicarboxyphenyl)triazin-5-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2nnnc(-c3cc(C(=O)O)cc(C(=O)O)c3)c2-c2cc(C(=O)O)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C27H15N3O12/c31-22(32)13-1-10(2-14(7-13)23(33)34)19-20(11-3-15(24(35)36)8-16(4-11)25(37)38)28-30-29-21(19)12-5-17(26(39)40)9-18(6-12)27(41)42/h1-9H,(H,31,32)(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | LCRKYQILILUWMJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 262.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |