C11H21NO — CID 177261989
(5S,6S)-5,6-dimethyl-1,3,4,4a,5,6,7,8,9,9a-decahydropyrano[3,4-c]azepine (PubChem CID 177261989) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (5S,6S)-5,6-dimethyl-1,3,4,4a,5,6,7,8,9,9a-decahydropyrano[3,4-c]azepine.
| Compound Name | (5S,6S)-5,6-dimethyl-1,3,4,4a,5,6,7,8,9,9a-decahydropyrano[3,4-c]azepine |
|---|---|
| PubChem CID | 177261989 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (5S,6S)-5,6-dimethyl-1,3,4,4a,5,6,7,8,9,9a-decahydropyrano[3,4-c]azepine |
| SMILES | C[C@@H]1CNCC2COCCC2[C@@H]1C |
| InChI | InChI=1S/C11H21NO/c1-8-5-12-6-10-7-13-4-3-11(10)9(8)2/h8-12H,3-7H2,1-2H3/t8-,9-,10?,11?/m1/s1 |
| InChIKey | FQHGYIQWQPUZHI-NKVNRFPTSA-N |
| XLogP | 1.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |