C20H28BrNO4 — CID 177266938
tert-butyl N-[(2-bromo-1-benzofuran-6-yl)methyl]-N-(2-butoxyethyl)carbamate (PubChem CID 177266938) has the molecular formula C20H28BrNO4 and a molecular weight of 426.35 g/mol. Its IUPAC name is tert-butyl N-[(2-bromo-1-benzofuran-6-yl)methyl]-N-(2-butoxyethyl)carbamate.
| Compound Name | tert-butyl N-[(2-bromo-1-benzofuran-6-yl)methyl]-N-(2-butoxyethyl)carbamate |
|---|---|
| PubChem CID | 177266938 |
| Molecular Formula | C20H28BrNO4 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | tert-butyl N-[(2-bromo-1-benzofuran-6-yl)methyl]-N-(2-butoxyethyl)carbamate |
| SMILES | CCCCOCCN(Cc1ccc2cc(Br)oc2c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28BrNO4/c1-5-6-10-24-11-9-22(19(23)26-20(2,3)4)14-15-7-8-16-13-18(21)25-17(16)12-15/h7-8,12-13H,5-6,9-11,14H2,1-4H3 |
| InChIKey | VNPRVWLGNMDWOT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|