C26H34N2O6S — CID 177267059
tert-butyl N-(2-butoxyethyl)-N-[[2-(phenylsulfamoyl)-1-benzofuran-6-yl]methyl]carbamate (PubChem CID 177267059) has the molecular formula C26H34N2O6S and a molecular weight of 502.63 g/mol. Its IUPAC name is tert-butyl N-(2-butoxyethyl)-N-[[2-(phenylsulfamoyl)-1-benzofuran-6-yl]methyl]carbamate.
| Compound Name | tert-butyl N-(2-butoxyethyl)-N-[[2-(phenylsulfamoyl)-1-benzofuran-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 177267059 |
| Molecular Formula | C26H34N2O6S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | tert-butyl N-(2-butoxyethyl)-N-[[2-(phenylsulfamoyl)-1-benzofuran-6-yl]methyl]carbamate |
| SMILES | CCCCOCCN(Cc1ccc2cc(S(=O)(=O)Nc3ccccc3)oc2c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H34N2O6S/c1-5-6-15-32-16-14-28(25(29)34-26(2,3)4)19-20-12-13-21-18-24(33-23(21)17-20)35(30,31)27-22-10-8-7-9-11-22/h7-13,17-18,27H,5-6,14-16,19H2,1-4H3 |
| InChIKey | JNCOPLNELRQEAX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|